cas: 53456-09-0 — see every product listed under this CAS number, including other names
2-Bromo-4-methylbenzoyl chloride, 95+% (CAS 53456-09-0) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A381912-5g |
| cas | 53456-09-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6417.25 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-bromo-4-methylbenzoyl chloride (CAS 53456-09-0) is a chemical compound with the molecular formula C8H6BrClO and a molecular weight of 233.49 g/mol. IUPAC name: 2-bromo-4-methylbenzoyl chloride. InChIKey: QYGFJEIQODJAQF-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO |
|---|---|
| Molecular weight | 233.49 g/mol |
| IUPAC name | 2-bromo-4-methylbenzoyl chloride |
| InChIKey | QYGFJEIQODJAQF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)Cl)Br |
Computed by PubChem (NCBI)