cas: 66949-40-4 — see every product listed under this CAS number, including other names
2-Bromo-4-nitrophenylacetic acid, 98+%, 98+% (CAS 66949-40-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117NDP-100mg |
| cas | 66949-40-4 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 707.60 Pln | |
| Chemat | 250mg | 981.20 Pln | |
| Chemat | 500mg | 1509.20 Pln | |
| Chemat | 1g | 1912.40 Pln | |
| Chemat | 5g | 5613.20 Pln | |
| Chemat | 10g | 10686.80 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
2-(2-bromo-4-nitrophenyl)acetic acid (CAS 66949-40-4) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: 2-(2-bromo-4-nitrophenyl)acetic acid. InChIKey: SWLSHEHNEIUTLA-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | 2-(2-bromo-4-nitrophenyl)acetic acid |
| InChIKey | SWLSHEHNEIUTLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Br)CC(=O)O |
Computed by PubChem (NCBI)