Products 916791-27-0
CAS 916791-27-0 is the registry number for 3-Bromomethyl-4-nitro-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(bromomethyl)-4-nitrobenzoic acid (CAS 916791-27-0) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: 3-(bromomethyl)-4-nitrobenzoic acid. InChIKey: YVGHVCRKHIIHPG-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | 3-(bromomethyl)-4-nitrobenzoic acid |
| InChIKey | YVGHVCRKHIIHPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)