CAS 104670-71-5 appears in our catalog under these names: Methyl 3-bromo-2-nitrobenzoate, 95%, Methyl 3-bromo-2-nitrobenzoate 97%, Methyl 3-bromo-2-nitrobenzoate, 98%, 98%, METHYL 3-BROMO-2-NITROBENZOATE, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 10g, 25g.
Methyl 3-bromo-2-nitrobenzoate (CAS 104670-71-5) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: methyl 3-bromo-2-nitrobenzoate. InChIKey: RPVJUANCLHFOFR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | methyl 3-bromo-2-nitrobenzoate |
| InChIKey | RPVJUANCLHFOFR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)