Products 5337-09-7
CAS 5337-09-7 appears in our catalog under these names: Methyl 2-bromo-3-nitrobenzoate, 98%, Methyl 2-bromo-3-nitrobenzoate, 97%, 97%, Methyl 2-bromo-3-nitrobenzoate, 97%, Methyl 2-bromo-3-nitrobenzoate, 96%. Offered by: Combi-blocks, Chemat, Ambeed, Fluorochem, BLDpharm. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250mg, 100mg.
Methyl 2-bromo-3-nitrobenzoate (CAS 5337-09-7) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: methyl 2-bromo-3-nitrobenzoate. InChIKey: YUWPKYJCYRFBJT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | methyl 2-bromo-3-nitrobenzoate |
| InChIKey | YUWPKYJCYRFBJT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)