cas: 218594-15-1 — see every product listed under this CAS number, including other names
2-Bromo-5-Boc-aminopyridine, 95%, 95% (CAS 218594-15-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148TB-250mg |
| cas | 218594-15-1 |
| size | 250mg |
| availability | 146g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 280.40 Pln | |
| Chemat | 25g | 606.80 Pln | |
| Chemat | 50g | 1029.20 Pln | |
| Chemat | 100g | 1854.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(6-bromo-3-pyridinyl)carbamate (CAS 218594-15-1) is a chemical compound with the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. IUPAC name: tert-butyl N-(6-bromo-3-pyridinyl)carbamate. InChIKey: LSFAQGJWQMNXLP-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | tert-butyl N-(6-bromo-3-pyridinyl)carbamate |
| InChIKey | LSFAQGJWQMNXLP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN=C(C=C1)Br |
Computed by PubChem (NCBI)