CAS 952664-76-5 is the registry number for N-t-Butyl 2-bromo-4-nitroaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
2-bromo-N-tert-butyl-4-nitroaniline (CAS 952664-76-5) is a chemical compound with the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. IUPAC name: 2-bromo-N-tert-butyl-4-nitroaniline. InChIKey: RYOITTMHFVTIQN-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 2-bromo-N-tert-butyl-4-nitroaniline |
| InChIKey | RYOITTMHFVTIQN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=C(C=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)