Products 1423037-45-9
CAS 1423037-45-9 is the registry number for Ethyl 3-amino-5-bromo-4-(methylamino)benzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Ethyl 3-amino-5-bromo-4-(methylamino)benzoate (CAS 1423037-45-9) is a chemical compound with the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. IUPAC name: ethyl 3-amino-5-bromo-4-(methylamino)benzoate. InChIKey: UDKKTELJVVIKFP-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | ethyl 3-amino-5-bromo-4-(methylamino)benzoate |
| InChIKey | UDKKTELJVVIKFP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)Br)NC)N |
Computed by PubChem (NCBI)