CAS 1135351-95-9 appears in our catalog under these names: N-t-Butyl 4-bromo-2-nitroaniline, 97%, 4-Bromo-N-(tert-butyl)-2-nitroaniline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
4-bromo-N-tert-butyl-2-nitroaniline (CAS 1135351-95-9) is a chemical compound with the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. IUPAC name: 4-bromo-N-tert-butyl-2-nitroaniline. InChIKey: SUIOMWQYRMBEHM-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 4-bromo-N-tert-butyl-2-nitroaniline |
| InChIKey | SUIOMWQYRMBEHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=C(C=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)