2-Bromo-5-chloroisonicotinic acid, 95%
cas: 530156-90-2 — see every product listed under this CAS number, including other names
2-Bromo-5-chloroisonicotinic acid, 95% (CAS 530156-90-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A247162-250mg |
| cas | 530156-90-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 665.19 Pln | |
| Ambeed | 25g | 2951.38 Pln | |
| Fluorochem | 1g | 211.40 Pln | |
| Fluorochem | 5g | 679.99 Pln | |
| Fluorochem | 10g | 1273.53 Pln | |
| Fluorochem | 25g | 3028.12 Pln | |
| BLDpharm | 250mg | 164.41 Pln | |
| BLDpharm | 1g | 236.61 Pln | |
| BLDpharm | 5g | 708.66 Pln | |
| BLDpharm | 25g | 3174.46 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-5-chloropyridine-4-carboxylic acid (CAS 530156-90-2) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 2-bromo-5-chloropyridine-4-carboxylic acid. InChIKey: DUOLMMJBAYMNEL-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 2-bromo-5-chloropyridine-4-carboxylic acid |
| InChIKey | DUOLMMJBAYMNEL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Br)Cl)C(=O)O |
Computed by PubChem (NCBI)