cas: 65550-79-0 — see every product listed under this CAS number, including other names
2-Bromo-5-chloronicotinic acid, 95% (CAS 65550-79-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093578-1G |
| cas | 65550-79-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 659.16 Pln | |
| Fluorochem | 10g | 1106.92 Pln | |
| Fluorochem | 25g | 2132.60 Pln | |
| Fluorochem | 100g | 7953.47 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-5-chloropyridine-3-carboxylic acid (CAS 65550-79-0) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 2-bromo-5-chloropyridine-3-carboxylic acid. InChIKey: KVUYLDGVNHUHCA-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 2-bromo-5-chloropyridine-3-carboxylic acid |
| InChIKey | KVUYLDGVNHUHCA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)Br)Cl |
Computed by PubChem (NCBI)