2-Bromo-5-isopropoxybenzaldehyde, 97%
cas: 162147-12-8 — see every product listed under this CAS number, including other names
2-Bromo-5-isopropoxybenzaldehyde, 97% (CAS 162147-12-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F540264-5G |
| cas | 162147-12-8 |
| size | 5g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 497.76 Pln | |
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 10g | 487.19 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 338.00 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 142.20 Pln | |
| BLDpharm | 5g | 297.70 Pln | |
| BLDpharm | 10g | 519.84 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2-bromo-5-propan-2-yloxybenzaldehyde (CAS 162147-12-8) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 2-bromo-5-propan-2-yloxybenzaldehyde. InChIKey: RFXGGROPXWWLIF-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 2-bromo-5-propan-2-yloxybenzaldehyde |
| InChIKey | RFXGGROPXWWLIF-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C=C1)Br)C=O |
Computed by PubChem (NCBI)