cas: 51039-53-3 — see every product listed under this CAS number, including other names
2-Bromo-5-phenyl-1,3,4-oxadiazole 95% (CAS 51039-53-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A109640-100mg |
| cas | 51039-53-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 453.81 Pln | |
| Ambeed | 5g | 1271.50 Pln | |
| Ambeed | 10g | 2100.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A109640 |
2-bromo-5-phenyl-1,3,4-oxadiazole (CAS 51039-53-3) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 2-bromo-5-phenyl-1,3,4-oxadiazole. InChIKey: XMTNHCRGHQLOEX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 2-bromo-5-phenyl-1,3,4-oxadiazole |
| InChIKey | XMTNHCRGHQLOEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)Br |
Computed by PubChem (NCBI)