CAS 51039-53-3 appears in our catalog under these names: 2-Bromo-5-phenyl-1,3,4-oxadiazole, 97%, 2-Bromo-5-phenyl-1,3,4-oxadiazole, 95%, 95%, 2-Bromo-5-phenyl-1,3,4-oxadiazole, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.
2-bromo-5-phenyl-1,3,4-oxadiazole (CAS 51039-53-3) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 2-bromo-5-phenyl-1,3,4-oxadiazole. InChIKey: XMTNHCRGHQLOEX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 2-bromo-5-phenyl-1,3,4-oxadiazole |
| InChIKey | XMTNHCRGHQLOEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)Br |
Computed by PubChem (NCBI)