cas: 91678-23-8 — see every product listed under this CAS number, including other names
2-Bromo-6-chloro-3-nitropyridine, 95% (CAS 91678-23-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077440-250MG |
| cas | 91678-23-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 690.40 Pln | |
| Fluorochem | 25g | 1580.71 Pln | |
| Fluorochem | 100g | 6157.22 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-6-chloro-3-nitropyridine (CAS 91678-23-8) is a chemical compound with the molecular formula C5H2BrClN2O2 and a molecular weight of 237.44 g/mol. IUPAC name: 2-bromo-6-chloro-3-nitropyridine. InChIKey: WISCKHBEOBONJA-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN2O2 |
|---|---|
| Molecular weight | 237.44 g/mol |
| IUPAC name | 2-bromo-6-chloro-3-nitropyridine |
| InChIKey | WISCKHBEOBONJA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])Br)Cl |
Computed by PubChem (NCBI)