cas: 3507-17-3 — see every product listed under this CAS number, including other names
2-Bromo-6-chlorobenzo[d]thiazole 97% (CAS 3507-17-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A158110-1g |
| cas | 3507-17-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 10g | 687.44 Pln | |
| Ambeed | 25g | 1605.25 Pln | |
| Ambeed | 250mg | 225.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A158110 |
2-bromo-6-chloro-1,3-benzothiazole (CAS 3507-17-3) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: 2-bromo-6-chloro-1,3-benzothiazole. InChIKey: SWCKCAROSKGHBI-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | 2-bromo-6-chloro-1,3-benzothiazole |
| InChIKey | SWCKCAROSKGHBI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)SC(=N2)Br |
Computed by PubChem (NCBI)