cas: 1060811-26-8 — see every product listed under this CAS number, including other names
2-Bromo-6-chloroisonicotinic acid, 95+% (CAS 1060811-26-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A504950-25g |
| cas | 1060811-26-8 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 78522.01 Pln | |
| AmBeed | 10g | 40015.36 Pln | |
| AmBeed | 5g | 23597.14 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-bromo-6-chloropyridine-4-carboxylic acid (CAS 1060811-26-8) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 2-bromo-6-chloropyridine-4-carboxylic acid. InChIKey: IBBONDAWVSODCZ-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 2-bromo-6-chloropyridine-4-carboxylic acid |
| InChIKey | IBBONDAWVSODCZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Br)C(=O)O |
Computed by PubChem (NCBI)