cas: 68236-35-1 — see every product listed under this CAS number, including other names
2-Bromo-6-chlorothieno[2,3-b]pyridine 98% (stabilized with Cu+HQ+MgO) (CAS 68236-35-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A499089-100mg |
| cas | 68236-35-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 492.75 Pln | |
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 1722.06 Pln | |
| Ambeed | 5g | 5727.06 Pln |
| purity | 98% (stabilized with Cu+HQ+MgO) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A499089 |
2-bromo-6-chlorothieno[2,3-b]pyridine (CAS 68236-35-1) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: 2-bromo-6-chlorothieno[2,3-b]pyridine. InChIKey: ZXVWVCBUASMPQD-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | 2-bromo-6-chlorothieno[2,3-b]pyridine |
| InChIKey | ZXVWVCBUASMPQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C=C(S2)Br)Cl |
Computed by PubChem (NCBI)