CAS 1387558-97-5 is the registry number for 2-Bromo-6-isopropoxybenzo[d]thiazole, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-6-propan-2-yloxy-1,3-benzothiazole (CAS 1387558-97-5) is a chemical compound with the molecular formula C10H10BrNOS and a molecular weight of 272.16 g/mol. IUPAC name: 2-bromo-6-propan-2-yloxy-1,3-benzothiazole. InChIKey: OKCFPLFSXVRRFE-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNOS |
|---|---|
| Molecular weight | 272.16 g/mol |
| IUPAC name | 2-bromo-6-propan-2-yloxy-1,3-benzothiazole |
| InChIKey | OKCFPLFSXVRRFE-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC2=C(C=C1)N=C(S2)Br |
Computed by PubChem (NCBI)