CAS 2169310-95-4 is the registry number for 8-Bromo-1,2,3,9b-tetrahydrobenzo[c]thieno[2,1,-e]isothiazole 4-oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
11-bromo-6lambda6-thia-7-azatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene 6-oxide (CAS 2169310-95-4) is a chemical compound with the molecular formula C10H10BrNOS and a molecular weight of 272.16 g/mol. IUPAC name: 11-bromo-6lambda6-thia-7-azatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene 6-oxide. InChIKey: DGANCLCSTCSDSM-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNOS |
|---|---|
| Molecular weight | 272.16 g/mol |
| IUPAC name | 11-bromo-6lambda6-thia-7-azatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene 6-oxide |
| InChIKey | DGANCLCSTCSDSM-UHFFFAOYSA-N |
| SMILES | C1CC2C3=C(C=CC(=C3)Br)N=S2(=O)C1 |
Computed by PubChem (NCBI)