CAS 139331-19-4 appears in our catalog under these names: 2-(2-Bromoethyl)-3,4-dihydro-2H-1,4-benzothiazin-3-one, 95%, 2-(2-Bromoethyl)-3,4-dihydro-2H-1,4-benzothiazin-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(2-bromoethyl)-4H-1,4-benzothiazin-3-one (CAS 139331-19-4) is a chemical compound with the molecular formula C10H10BrNOS and a molecular weight of 272.16 g/mol. IUPAC name: 2-(2-bromoethyl)-4H-1,4-benzothiazin-3-one. InChIKey: WRCXYTDZMOOWSK-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNOS |
|---|---|
| Molecular weight | 272.16 g/mol |
| IUPAC name | 2-(2-bromoethyl)-4H-1,4-benzothiazin-3-one |
| InChIKey | WRCXYTDZMOOWSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)C(S2)CCBr |
Computed by PubChem (NCBI)