CAS 1172835-03-8 is the registry number for 4-(4-Methyl-1,3-thiazol-2-yl)phenol hydrobromide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-(4-methyl-1,3-thiazol-2-yl)phenol;hydrobromide (CAS 1172835-03-8) is a chemical compound with the molecular formula C10H10BrNOS and a molecular weight of 272.16 g/mol. IUPAC name: 4-(4-methyl-1,3-thiazol-2-yl)phenol;hydrobromide. InChIKey: AOSROIZJLXYMCM-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNOS |
|---|---|
| Molecular weight | 272.16 g/mol |
| IUPAC name | 4-(4-methyl-1,3-thiazol-2-yl)phenol;hydrobromide |
| InChIKey | AOSROIZJLXYMCM-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)C2=CC=C(C=C2)O.Br |
Computed by PubChem (NCBI)