cas: 3507-58-2 — see every product listed under this CAS number, including other names
2-Bromo-7-chlorobenzo[d]thiazole 95% (CAS 3507-58-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A184646-100mg |
| cas | 3507-58-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 698.56 Pln | |
| Ambeed | 250mg | 915.50 Pln | |
| Ambeed | 1g | 1777.69 Pln | |
| Ambeed | 5g | 5688.12 Pln | |
| Ambeed | 25g | 19733.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A184646 |
2-bromo-7-chloro-1,3-benzothiazole (CAS 3507-58-2) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: 2-bromo-7-chloro-1,3-benzothiazole. InChIKey: RXKINMFVXOEAHJ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | 2-bromo-7-chloro-1,3-benzothiazole |
| InChIKey | RXKINMFVXOEAHJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)SC(=N2)Br |
Computed by PubChem (NCBI)