cas: 79839-66-0 — see every product listed under this CAS number, including other names
2-Bromo-N,N-diisopropylbenzamide, 97% (CAS 79839-66-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A588779-5g |
| cas | 79839-66-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 200.20 Pln | |
| AmBeed | 1g | 154.63 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-bromo-N,N-di(propan-2-yl)benzamide (CAS 79839-66-0) is a chemical compound with the molecular formula C13H18BrNO and a molecular weight of 284.19 g/mol. IUPAC name: 2-bromo-N,N-di(propan-2-yl)benzamide. InChIKey: CFGJWHGKVALRSD-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO |
|---|---|
| Molecular weight | 284.19 g/mol |
| IUPAC name | 2-bromo-N,N-di(propan-2-yl)benzamide |
| InChIKey | CFGJWHGKVALRSD-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=CC=C1Br |
Computed by PubChem (NCBI)