Products 35309-72-9
CAS 35309-72-9 is the registry number for 3-Bromo-N,N-diisopropylbenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-N,N-di(propan-2-yl)benzamide (CAS 35309-72-9) is a chemical compound with the molecular formula C13H18BrNO and a molecular weight of 284.19 g/mol. IUPAC name: 3-bromo-N,N-di(propan-2-yl)benzamide. InChIKey: DBWZQUIZKNKCRM-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO |
|---|---|
| Molecular weight | 284.19 g/mol |
| IUPAC name | 3-bromo-N,N-di(propan-2-yl)benzamide |
| InChIKey | DBWZQUIZKNKCRM-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)