Products 79839-66-0
CAS 79839-66-0 appears in our catalog under these names: N-Diisopropyl 2-bromobenzamide, 97%, 2-Bromo-N,N-diisopropylbenzamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 500g, 5g.
2-bromo-N,N-di(propan-2-yl)benzamide (CAS 79839-66-0) is a chemical compound with the molecular formula C13H18BrNO and a molecular weight of 284.19 g/mol. IUPAC name: 2-bromo-N,N-di(propan-2-yl)benzamide. InChIKey: CFGJWHGKVALRSD-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO |
|---|---|
| Molecular weight | 284.19 g/mol |
| IUPAC name | 2-bromo-N,N-di(propan-2-yl)benzamide |
| InChIKey | CFGJWHGKVALRSD-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=CC=C1Br |
Computed by PubChem (NCBI)