CAS 79606-46-5 appears in our catalog under these names: N-Diisopropyl 4-bromobenzamide, 98%, 4-Bromo-N,N-diisopropylbenzamide 98%, 4-Bromo-N,N-bis(1-methylethyl)benzamide, 98%, 98%, 4-Bromo-N,N-diisopropylbenzamide, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 100g.
4-bromo-N,N-di(propan-2-yl)benzamide (CAS 79606-46-5) is a chemical compound with the molecular formula C13H18BrNO and a molecular weight of 284.19 g/mol. IUPAC name: 4-bromo-N,N-di(propan-2-yl)benzamide. InChIKey: ZRHGXOKPARSBQA-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO |
|---|---|
| Molecular weight | 284.19 g/mol |
| IUPAC name | 4-bromo-N,N-di(propan-2-yl)benzamide |
| InChIKey | ZRHGXOKPARSBQA-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)