cas: 2052-07-5 — see every product listed under this CAS number, including other names
2-Bromobiphenyl, 97.50% (CAS 2052-07-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM13370K-25g |
| cas | 2052-07-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 568.80 Pln | |
| Chemat | 5g | 194.79 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 97.50% |
| category | Chemicals |
1-bromo-2-phenylbenzene (CAS 2052-07-5) is a chemical compound with the molecular formula C12H9Br and a molecular weight of 233.10 g/mol. IUPAC name: 1-bromo-2-phenylbenzene. InChIKey: KTADSLDAUJLZGL-UHFFFAOYSA-N.
| Molecular formula | C12H9Br |
|---|---|
| Molecular weight | 233.10 g/mol |
| IUPAC name | 1-bromo-2-phenylbenzene |
| InChIKey | KTADSLDAUJLZGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)