CAS 2052-07-5 appears in our catalog under these names: 2-Bromobiphenyl, 98%, 2-Bromo-1,1'-biphenyl, >95% (HPLC), PBB No. 1, 2-Bromobiphenyl/ 98% (EVE/EUD), 2-Bromobiphenyl, 98% . Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, Chemat, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 500g, 5g, 100g, 1g, 50mg, 10g, 1kg.
1-bromo-2-phenylbenzene (CAS 2052-07-5) is a chemical compound with the molecular formula C12H9Br and a molecular weight of 233.10 g/mol. IUPAC name: 1-bromo-2-phenylbenzene. InChIKey: KTADSLDAUJLZGL-UHFFFAOYSA-N.
| Molecular formula | C12H9Br |
|---|---|
| Molecular weight | 233.10 g/mol |
| IUPAC name | 1-bromo-2-phenylbenzene |
| InChIKey | KTADSLDAUJLZGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)