2-Bromocarbazole, 98%
cas: 3652-90-2 — see every product listed under this CAS number, including other names
2-Bromocarbazole, 98% (CAS 3652-90-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A112061-250mg |
| cas | 3652-90-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 170.12 Pln | |
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 859.88 Pln | |
| Ambeed | 500g | 4008.25 Pln | |
| Ambeed | 1kg | 6761.69 Pln | |
| Fluorochem | 1g | 102.06 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 211.40 Pln | |
| Fluorochem | 100g | 607.10 Pln | |
| Fluorochem | 500g | 2757.38 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-9H-carbazole (CAS 3652-90-2) is a chemical compound with the molecular formula C12H8BrN and a molecular weight of 246.10 g/mol. IUPAC name: 2-bromo-9H-carbazole. InChIKey: PJRGCJBBXGNEGD-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 2-bromo-9H-carbazole |
| InChIKey | PJRGCJBBXGNEGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=C(C=C3)Br |
Computed by PubChem (NCBI)