cas: 20972-38-7 — see every product listed under this CAS number, including other names
2-Butenoic acid, 4-(4-bromophenyl)-4-oxo-, (E)-, 98% (CAS 20972-38-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F980628-1G |
| cas | 20972-38-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 450.90 Pln | |
| Fluorochem | 10g | 716.43 Pln | |
| Fluorochem | 25g | 1606.74 Pln | |
| Fluorochem | 100g | 5350.22 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(E)-4-(4-bromophenyl)-4-oxobut-2-enoic acid (CAS 20972-38-7) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: (E)-4-(4-bromophenyl)-4-oxobut-2-enoic acid. InChIKey: CJNVLFPUEBQQMZ-AATRIKPKSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | (E)-4-(4-bromophenyl)-4-oxobut-2-enoic acid |
| InChIKey | CJNVLFPUEBQQMZ-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1C(=O)/C=C/C(=O)O)Br |
Computed by PubChem (NCBI)