Products 39644-80-9
CAS 39644-80-9 appears in our catalog under these names: 3-(4-Bromobenzoyl)-acrylic acid, 3-(4-Bromobenzoyl)acrylic acid, 95%, 95%, 3-(4-Bromobenzoyl)acrylic acid, 95%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
(E)-4-(4-bromophenyl)-4-oxobut-2-enoic acid (CAS 39644-80-9) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: (E)-4-(4-bromophenyl)-4-oxobut-2-enoic acid. InChIKey: CJNVLFPUEBQQMZ-AATRIKPKSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | (E)-4-(4-bromophenyl)-4-oxobut-2-enoic acid |
| InChIKey | CJNVLFPUEBQQMZ-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1C(=O)/C=C/C(=O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
(2E)-4-(4-bromophenyl)-4-oxo-2-butenoic acid, 3-(4-Bromobenzoyl)acrylic acid, (E)-4-(4-bromophenyl)-4-oxobut-2-enoic acid, (2E)-4-(4-bromophenyl)-4-oxobut-2-enoic acid, 2-Butenoic acid, 4-(4-bromophenyl)-4-oxo-, (E)-, 2-butenoic acid, 4-(4-bromophenyl)-4-oxo-, (2E)-, (E)-3-(4-Bromobenzoyl)acrylic acid, 3-(4-Bromobenzoyl)-acrylic acid, 4-(4-Bromophenyl)-4-oxo-2-butenoic acid, (2E)-3-(4-Bromobenzoyl)acrylic acid