cas: 99903-01-2 — see every product listed under this CAS number, including other names
2-CHLORO-5-(METHYLSULFONYL)PYRIDINE, 97% (CAS 99903-01-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F474504-100MG |
| cas | 99903-01-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 487.35 Pln | |
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 1g | 2064.92 Pln | |
| Fluorochem | 5g | 4813.95 Pln | |
| Fluorochem | 10g | 8151.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-5-methylsulfonylpyridine (CAS 99903-01-2) is a chemical compound with the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. IUPAC name: 2-chloro-5-methylsulfonylpyridine. InChIKey: QGZFEPYQSVATSQ-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO2S |
|---|---|
| Molecular weight | 191.64 g/mol |
| IUPAC name | 2-chloro-5-methylsulfonylpyridine |
| InChIKey | QGZFEPYQSVATSQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CN=C(C=C1)Cl |
Computed by PubChem (NCBI)