Products 341008-95-5
CAS 341008-95-5 appears in our catalog under these names: 4-Methyl-2-pyridinesulfonyl chloride, 95%, 95%, 4-Methylpyridine-2-sulfonyl chloride 95%, 4-Methyl-pyridine-2-sulfonyl chloride, 95%, 4-Methylpyridine-2-sulfonyl chloride, 98%. Offered by: Chemat, Ambeed, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-methylpyridine-2-sulfonyl chloride (CAS 341008-95-5) is a chemical compound with the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. IUPAC name: 4-methylpyridine-2-sulfonyl chloride. InChIKey: YIQOZBGOBMKGRZ-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO2S |
|---|---|
| Molecular weight | 191.64 g/mol |
| IUPAC name | 4-methylpyridine-2-sulfonyl chloride |
| InChIKey | YIQOZBGOBMKGRZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)