Products 1080061-38-6

CAS 1080061-38-6 appears in our catalog under these names: 5-Chloro-2-(1,3-dioxolan-2-yl)-1,3-thiazole, 95%, 5-Chloro-2-(1,3-dioxolan-2-yl)thiazole, 98+%, 5-Chloro-2-(1,3-dioxolan-2-yl)-1,3-thiazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 100mg.

Structural formula: {0} (CAS {1})

5-chloro-2-(1,3-dioxolan-2-yl)-1,3-thiazole (CAS 1080061-38-6) is a chemical compound with the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. IUPAC name: 5-chloro-2-(1,3-dioxolan-2-yl)-1,3-thiazole. InChIKey: WUWYXXPBSVMFAU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6ClNO2S
Molecular weight191.64 g/mol
IUPAC name5-chloro-2-(1,3-dioxolan-2-yl)-1,3-thiazole
InChIKeyWUWYXXPBSVMFAU-UHFFFAOYSA-N
SMILESC1COC(O1)C2=NC=C(S2)Cl

Computed by PubChem (NCBI)