cas: 112601-16-8 — see every product listed under this CAS number, including other names
2-CHLORO-6-(TRIFLUOROMETHYL)IMIDAZO[1,2-A]PYRIDINE, 97% (CAS 112601-16-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F505734-100MG |
| cas | 112601-16-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 810.15 Pln | |
| Fluorochem | 250mg | 1408.90 Pln | |
| Fluorochem | 500mg | 2632.42 Pln | |
| Fluorochem | 1g | 2642.84 Pln | |
| Fluorochem | 5g | 12998.57 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 112601-16-8) is a chemical compound with the molecular formula C8H4ClF3N2 and a molecular weight of 220.58 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: RDWNBEBIDGNGFK-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3N2 |
|---|---|
| Molecular weight | 220.58 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | RDWNBEBIDGNGFK-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1C(F)(F)F)Cl |
Computed by PubChem (NCBI)