cas: 347-66-0 — see every product listed under this CAS number, including other names
2-CHLORO-N-(2-FLUOROPHENYL)ACETAMIDE, 97%, 97% (CAS 347-66-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 100mg, 1g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118BU1-250mg |
| cas | 347-66-0 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 5g | 410.00 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 10g | 712.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-N-(2-fluorophenyl)acetamide (CAS 347-66-0) is a chemical compound with the molecular formula C8H7ClFNO and a molecular weight of 187.60 g/mol. IUPAC name: 2-chloro-N-(2-fluorophenyl)acetamide. InChIKey: YHJYFDQKFJQLNL-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO |
|---|---|
| Molecular weight | 187.60 g/mol |
| IUPAC name | 2-chloro-N-(2-fluorophenyl)acetamide |
| InChIKey | YHJYFDQKFJQLNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)CCl)F |
Computed by PubChem (NCBI)