CAS 55239-51-5 appears in our catalog under these names: N-(4-Fluorophenyl)-N-methylcarbamoyl chloride, 95%, N-(4-Fluorophenyl)-N-methylcarbamoyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 0,5g, 50mg.
N-(4-fluorophenyl)-N-methylcarbamoyl chloride (CAS 55239-51-5) is a chemical compound with the molecular formula C8H7ClFNO and a molecular weight of 187.60 g/mol. IUPAC name: N-(4-fluorophenyl)-N-methylcarbamoyl chloride. InChIKey: FHBDZQWYXALRHT-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO |
|---|---|
| Molecular weight | 187.60 g/mol |
| IUPAC name | N-(4-fluorophenyl)-N-methylcarbamoyl chloride |
| InChIKey | FHBDZQWYXALRHT-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)F)C(=O)Cl |
Computed by PubChem (NCBI)