CAS 877-90-7 appears in our catalog under these names: 3'-Chloro-4'-fluoroacetanilide, 95%, 3′–Chloro–4′–fluoroacetanilide, N-(3-chloro-4-fluorophenyl)acetamide, 98%, 98%, N-(3-Chloro-4-fluorophenyl)acetamide, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 1g, 100g, 5g, 10g, 500g.
N-(3-chloro-4-fluorophenyl)acetamide (CAS 877-90-7) is a chemical compound with the molecular formula C8H7ClFNO and a molecular weight of 187.60 g/mol. IUPAC name: N-(3-chloro-4-fluorophenyl)acetamide. InChIKey: ALPHMTFVUKDBGJ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO |
|---|---|
| Molecular weight | 187.60 g/mol |
| IUPAC name | N-(3-chloro-4-fluorophenyl)acetamide |
| InChIKey | ALPHMTFVUKDBGJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)F)Cl |
Computed by PubChem (NCBI)