CAS 1865077-51-5 appears in our catalog under these names: 3-Chloro-5-fluoro-N-methylbenzamide, 3-chloro-5-fluoro-N-methylbenzamide, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 5g.
3-chloro-5-fluoro-N-methylbenzamide (CAS 1865077-51-5) is a chemical compound with the molecular formula C8H7ClFNO and a molecular weight of 187.60 g/mol. IUPAC name: 3-chloro-5-fluoro-N-methylbenzamide. InChIKey: VZNZGFVVNHMYET-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO |
|---|---|
| Molecular weight | 187.60 g/mol |
| IUPAC name | 3-chloro-5-fluoro-N-methylbenzamide |
| InChIKey | VZNZGFVVNHMYET-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=CC(=C1)Cl)F |
Computed by PubChem (NCBI)