cas: 35022-42-5 — see every product listed under this CAS number, including other names
2-CHLOROBENZOYL CYANIDE, 95% (CAS 35022-42-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F333901-1G |
| cas | 35022-42-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 768.50 Pln | |
| Fluorochem | 5g | 2996.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-chlorobenzoyl cyanide (CAS 35022-42-5) is a chemical compound with the molecular formula C8H4ClNO and a molecular weight of 165.57 g/mol. IUPAC name: 2-chlorobenzoyl cyanide. InChIKey: YUCRNASRVPZKNQ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO |
|---|---|
| Molecular weight | 165.57 g/mol |
| IUPAC name | 2-chlorobenzoyl cyanide |
| InChIKey | YUCRNASRVPZKNQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C#N)Cl |
Computed by PubChem (NCBI)