CAS 1711-11-1 appears in our catalog under these names: 3–Cyanobenzoyl chloride, 3-Cyanobenzoyl chloride 95%, 3-CYANOBENZOYL CHLORIDE, 99%, 3-Cyanobenzoyl chloride, 98%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
3-cyanobenzoyl chloride (CAS 1711-11-1) is a chemical compound with the molecular formula C8H4ClNO and a molecular weight of 165.57 g/mol. IUPAC name: 3-cyanobenzoyl chloride. InChIKey: RPESZQVUWMFBEO-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO |
|---|---|
| Molecular weight | 165.57 g/mol |
| IUPAC name | 3-cyanobenzoyl chloride |
| InChIKey | RPESZQVUWMFBEO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)Cl)C#N |
Computed by PubChem (NCBI)