CAS 27611-63-8 is the registry number for 2-Cyanobenzoylchloride, 95+%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
2-cyanobenzoyl chloride (CAS 27611-63-8) is a chemical compound with the molecular formula C8H4ClNO and a molecular weight of 165.57 g/mol. IUPAC name: 2-cyanobenzoyl chloride. InChIKey: STNAQENUCOFEKN-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO |
|---|---|
| Molecular weight | 165.57 g/mol |
| IUPAC name | 2-cyanobenzoyl chloride |
| InChIKey | STNAQENUCOFEKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C(=O)Cl |
Computed by PubChem (NCBI)