CAS 35022-42-5 appears in our catalog under these names: (2-Chloro-phenyl)-oxo-acetonitrile, 95%, 2–Chlorobenzoyl cyanide, 2-Chlorobenzoyl cyanide 95%, 2-Chlorobenzoyl cyanide, 95%, 95%, 2-CHLOROBENZOYL CYANIDE, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 100mg, 250mg.
2-chlorobenzoyl cyanide (CAS 35022-42-5) is a chemical compound with the molecular formula C8H4ClNO and a molecular weight of 165.57 g/mol. IUPAC name: 2-chlorobenzoyl cyanide. InChIKey: YUCRNASRVPZKNQ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO |
|---|---|
| Molecular weight | 165.57 g/mol |
| IUPAC name | 2-chlorobenzoyl cyanide |
| InChIKey | YUCRNASRVPZKNQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C#N)Cl |
Computed by PubChem (NCBI)