CAS 3156-34-1 appears in our catalog under these names: 1–(2–Chlorophenyl)–2–nitroethylene, 1-(2-Chlorophenyl)-2-nitroethylene 98% (only trans-), 1-(2-Chlorophenyl)-2-nitroethylene, 98% (only trans-), 2-Chloro-^b-nitrostyrene, 98% . Offered by: GLPBio, Ambeed, Fluorochem, Thermo Scientific (Alfa Aesar). Available pack sizes: 100g, 25g, 5g, 1g.
1-chloro-2-[(E)-2-nitroethenyl]benzene (CAS 3156-34-1) is a chemical compound with the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. IUPAC name: 1-chloro-2-[(E)-2-nitroethenyl]benzene. InChIKey: QHKJTRDWAZGBLR-AATRIKPKSA-N.
| Molecular formula | C8H6ClNO2 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 1-chloro-2-[(E)-2-nitroethenyl]benzene |
| InChIKey | QHKJTRDWAZGBLR-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)