CAS 1347814-95-2 appears in our catalog under these names: {5-Chlorofuro(3,2-b)pyridin-2-yl}methanol, (5-Chlorofuro[3,2-b]pyridin-2-yl)methanol, 95%, {5-chlorofuro(3,2-b)pyridin-2-yl}methanol, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 5g, 100mg, 1g, 250mg.
(5-chlorofuro[3,2-b]pyridin-2-yl)methanol (CAS 1347814-95-2) is a chemical compound with the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. IUPAC name: (5-chlorofuro[3,2-b]pyridin-2-yl)methanol. InChIKey: KEGRTUBZRMQESQ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | (5-chlorofuro[3,2-b]pyridin-2-yl)methanol |
| InChIKey | KEGRTUBZRMQESQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1OC(=C2)CO)Cl |
Computed by PubChem (NCBI)