CAS 27320-99-6 appears in our catalog under these names: 7-Chloro-2h-1,4-benzoxazin-3(4h)-one, 98%, 7-Chloro-2H-benzo[b][1,4]oxazin-3(4H)-one 97%, 7-Chloro-2H-benzo[b][1,4]oxazin-3(4H)-one, 95%, 95%, 7-Chloro-2H-1,4-benzoxazin-3(4H)-one, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, 100mg.
7-chloro-4H-1,4-benzoxazin-3-one (CAS 27320-99-6) is a chemical compound with the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. IUPAC name: 7-chloro-4H-1,4-benzoxazin-3-one. InChIKey: QGHYYLMIQSZWAX-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 7-chloro-4H-1,4-benzoxazin-3-one |
| InChIKey | QGHYYLMIQSZWAX-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)