Products 138035-68-4
CAS 138035-68-4 appears in our catalog under these names: 5-Chloro-2h-benzo[b][1,4]oxazin-3(4h)-one, 95%, 5-Chloro-2H-benzo[b][1,4]oxazin-3(4H)-one, 95+%, 95+%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
5-chloro-4H-1,4-benzoxazin-3-one (CAS 138035-68-4) is a chemical compound with the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. IUPAC name: 5-chloro-4H-1,4-benzoxazin-3-one. InChIKey: WGLKZFRQDQEPMU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 5-chloro-4H-1,4-benzoxazin-3-one |
| InChIKey | WGLKZFRQDQEPMU-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC=C2Cl |
Computed by PubChem (NCBI)