cas: 140665-34-5 — see every product listed under this CAS number, including other names
2-Chloro-1,3,4-trimethoxybenzene, 95%, 95% (CAS 140665-34-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HVVT-100mg |
| cas | 140665-34-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 683.60 Pln | |
| Chemat | 250mg | 1278.80 Pln | |
| Chemat | 1g | 2498.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-chloro-1,3,4-trimethoxybenzene (CAS 140665-34-5) is a chemical compound with the molecular formula C9H11ClO3 and a molecular weight of 202.63 g/mol. IUPAC name: 2-chloro-1,3,4-trimethoxybenzene. InChIKey: LAKKTEWECMKSJS-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3 |
|---|---|
| Molecular weight | 202.63 g/mol |
| IUPAC name | 2-chloro-1,3,4-trimethoxybenzene |
| InChIKey | LAKKTEWECMKSJS-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)OC)Cl)OC |
Computed by PubChem (NCBI)