Products 131264-68-1
CAS 131264-68-1 is the registry number for 4-Chloromethyl-5-methyl-furan-2-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
Ethyl 4-(chloromethyl)-5-methylfuran-2-carboxylate (CAS 131264-68-1) is a chemical compound with the molecular formula C9H11ClO3 and a molecular weight of 202.63 g/mol. IUPAC name: ethyl 4-(chloromethyl)-5-methylfuran-2-carboxylate. InChIKey: MWPBLOXDMFJBHD-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3 |
|---|---|
| Molecular weight | 202.63 g/mol |
| IUPAC name | ethyl 4-(chloromethyl)-5-methylfuran-2-carboxylate |
| InChIKey | MWPBLOXDMFJBHD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(O1)C)CCl |
Computed by PubChem (NCBI)